C15H23ClN2O3 — CID 119064750
1-[(5-chloro-2-methoxyphenyl)methyl]-3-(3-ethoxypropyl)-1-methylurea (PubChem CID 119064750) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)methyl]-3-(3-ethoxypropyl)-1-methylurea.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)methyl]-3-(3-ethoxypropyl)-1-methylurea |
|---|---|
| PubChem CID | 119064750 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)methyl]-3-(3-ethoxypropyl)-1-methylurea |
| SMILES | CCOCCCNC(=O)N(C)Cc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H23ClN2O3/c1-4-21-9-5-8-17-15(19)18(2)11-12-10-13(16)6-7-14(12)20-3/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,17,19) |
| InChIKey | DNHZJTQEHMYYGY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|