C18H20ClFN2O3 — CID 87008091
3-[(5-chloro-2-methoxyphenyl)methyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea (PubChem CID 87008091) has the molecular formula C18H20ClFN2O3 and a molecular weight of 366.82 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxyphenyl)methyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea.
| Compound Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 87008091 |
| Molecular Formula | C18H20ClFN2O3 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea |
| SMILES | COc1ccc(CN(C)C(=O)NCc2cc(Cl)ccc2OC)cc1F |
| InChI | InChI=1S/C18H20ClFN2O3/c1-22(11-12-4-6-17(25-3)15(20)8-12)18(23)21-10-13-9-14(19)5-7-16(13)24-2/h4-9H,10-11H2,1-3H3,(H,21,23) |
| InChIKey | ZVCIBTIOUHZZDY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |