C16H25ClN2O2 — CID 86999313
3-(3-butoxypropyl)-1-[(3-chlorophenyl)methyl]-1-methylurea (PubChem CID 86999313) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 3-(3-butoxypropyl)-1-[(3-chlorophenyl)methyl]-1-methylurea.
| Compound Name | 3-(3-butoxypropyl)-1-[(3-chlorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 86999313 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-(3-butoxypropyl)-1-[(3-chlorophenyl)methyl]-1-methylurea |
| SMILES | CCCCOCCCNC(=O)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-3-4-10-21-11-6-9-18-16(20)19(2)13-14-7-5-8-15(17)12-14/h5,7-8,12H,3-4,6,9-11,13H2,1-2H3,(H,18,20) |
| InChIKey | USAMRNBEVGPVAM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|