C16H26ClN3O — CID 111176582
1-(3-butoxypropyl)-3-[(3-chlorophenyl)methyl]-2-methylguanidine (PubChem CID 111176582) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[(3-chlorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-(3-butoxypropyl)-3-[(3-chlorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111176582 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[(3-chlorophenyl)methyl]-2-methylguanidine |
| SMILES | CCCCOCCCN/C(=N\C)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H26ClN3O/c1-3-4-10-21-11-6-9-19-16(18-2)20-13-14-7-5-8-15(17)12-14/h5,7-8,12H,3-4,6,9-11,13H2,1-2H3,(H2,18,19,20) |
| InChIKey | WSQYBHZURRFOMH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|