C25H37N3O3 — CID 111693150
1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[3-(phenylmethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111693150) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[3-(phenylmethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[3-(phenylmethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111693150 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[3-(phenylmethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCCCOCCOCCN/C(=N\C)NCc1cccc(COCc2ccccc2)c1 |
| InChI | InChI=1S/C25H37N3O3/c1-3-4-14-29-16-17-30-15-13-27-25(26-2)28-19-23-11-8-12-24(18-23)21-31-20-22-9-6-5-7-10-22/h5-12,18H,3-4,13-17,19-21H2,1-2H3,(H2,26,27,28) |
| InChIKey | DNFYIBYHERGZNC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|