C16H19N3O2 — CID 40637158
1-(4-ethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea (PubChem CID 40637158) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 40637158 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea |
| SMILES | CCOc1ccc(NC(=O)N[C@@H](C)c2ccncc2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-3-21-15-6-4-14(5-7-15)19-16(20)18-12(2)13-8-10-17-11-9-13/h4-12H,3H2,1-2H3,(H2,18,19,20)/t12-/m0/s1 |
| InChIKey | ZVWNHZNFUHNITN-LBPRGKRZSA-N |
| XLogP | 3.36 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |