C18H18F3N3O3 — CID 42887485
4-[2-[4-(2,2,2-trifluoroethoxy)anilino]propanoylamino]benzamide (PubChem CID 42887485) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 4-[2-[4-(2,2,2-trifluoroethoxy)anilino]propanoylamino]benzamide.
| Compound Name | 4-[2-[4-(2,2,2-trifluoroethoxy)anilino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 42887485 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-[2-[4-(2,2,2-trifluoroethoxy)anilino]propanoylamino]benzamide |
| SMILES | CC(Nc1ccc(OCC(F)(F)F)cc1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-11(17(26)24-14-4-2-12(3-5-14)16(22)25)23-13-6-8-15(9-7-13)27-10-18(19,20)21/h2-9,11,23H,10H2,1H3,(H2,22,25)(H,24,26) |
| InChIKey | KJTSALIEYMUGAK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|