C14H19F3N2O2 — CID 103831151
(2S)-2-amino-N-[4-(2,2,2-trifluoroethoxy)phenyl]hexanamide (PubChem CID 103831151) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(2,2,2-trifluoroethoxy)phenyl]hexanamide.
| Compound Name | (2S)-2-amino-N-[4-(2,2,2-trifluoroethoxy)phenyl]hexanamide |
|---|---|
| PubChem CID | 103831151 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2S)-2-amino-N-[4-(2,2,2-trifluoroethoxy)phenyl]hexanamide |
| SMILES | CCCC[C@H](N)C(=O)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-2-3-4-12(18)13(20)19-10-5-7-11(8-6-10)21-9-14(15,16)17/h5-8,12H,2-4,9,18H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | QQASCDCUEKGDEF-LBPRGKRZSA-N |
| XLogP | 3.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |