About N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline
N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline (PubChem CID 43686731) has the molecular formula C12H16F3NO
and a molecular weight of 247.26 g/mol. Its IUPAC name is N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline.
Molecular Properties
| Compound Name | N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline |
| PubChem CID | 43686731 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline |
| SMILES | CCC(C)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3NO/c1-3-9(2)16-10-4-6-11(7-5-10)17-8-12(13,14)15/h4-7,9,16H,3,8H2,1-2H3 |
| InChIKey | OJPLNCVBUKODNQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline?
The IUPAC name of N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline (CID 43686731) is N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline.
What is the SMILES notation for N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline?
The canonical SMILES for N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline is CCC(C)Nc1ccc(OCC(F)(F)F)cc1.
What is the InChIKey of N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline?
The InChIKey is OJPLNCVBUKODNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO/c1-3-9(2)16-10-4-6-11(7-5-10)17-8-12(13,14)15/h4-7,9,16H,3,8H2,1-2H3.
What are the key properties of N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline?
N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline has a molecular weight of 247.26 g/mol, XLogP of 3.84, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-4-(2,2,2-trifluoroethoxy)aniline is sourced from PubChem (CID 43686731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).