C15H14ClF3N2O — CID 133373348
2-chloro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-4-amine (PubChem CID 133373348) has the molecular formula C15H14ClF3N2O and a molecular weight of 330.74 g/mol. Its IUPAC name is 2-chloro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133373348 |
| Molecular Formula | C15H14ClF3N2O |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-chloro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-4-amine |
| SMILES | CC(Nc1ccnc(Cl)c1)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14ClF3N2O/c1-10(21-12-6-7-20-14(16)8-12)11-2-4-13(5-3-11)22-9-15(17,18)19/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | UGXPFYDZZINGKQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|