C19H19F3N2O2 — CID 141282003
6-methoxy-1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoline (PubChem CID 141282003) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 6-methoxy-1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoline.
| Compound Name | 6-methoxy-1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoline |
|---|---|
| PubChem CID | 141282003 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 6-methoxy-1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoline |
| SMILES | COc1ccc2c(c1)C=CCN2[C@H](C)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C19H19F3N2O2/c1-13(17-7-5-16(11-23-17)26-12-19(20,21)22)24-9-3-4-14-10-15(25-2)6-8-18(14)24/h3-8,10-11,13H,9,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | DREUMEVVLNGCQF-CYBMUJFWSA-N |
| XLogP | 4.63 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|