C28H24F5N5O3S — CID 156895226
1-[5-ethylsulfanyl-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]-1-oxidopyridin-1-ium-3-yl]cyclopropane-1-carbonitrile (PubChem CID 156895226) has the molecular formula C28H24F5N5O3S and a molecular weight of 605.59 g/mol. Its IUPAC name is 1-[5-ethylsulfanyl-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]-1-oxidopyridin-1-ium-3-yl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[5-ethylsulfanyl-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]-1-oxidopyridin-1-ium-3-yl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 156895226 |
| Molecular Formula | C28H24F5N5O3S |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | 1-[5-ethylsulfanyl-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]-1-oxidopyridin-1-ium-3-yl]cyclopropane-1-carbonitrile |
| SMILES | CCSc1cc(C2(C#N)CC2)c[n+]([O-])c1-c1cc2c(cn1)n(CC(F)(F)C(F)(F)F)c(=O)n2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H24F5N5O3S/c1-3-42-23-10-18(26(15-34)8-9-26)14-38(40)24(23)20-11-21-22(12-35-20)37(16-27(29,30)28(31,32)33)25(39)36(21)13-17-4-6-19(41-2)7-5-17/h4-7,10-12,14H,3,8-9,13,16H2,1-2H3 |
| InChIKey | OSTFKAWFQAOWDU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 99.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|