C22H22ClF5N4OS — CID 156895189
6-[5-(1-chlorocyclopropyl)-3-ethylsulfanyl-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropyl)-1-propan-2-ylimidazo[4,5-c]pyridin-2-one (PubChem CID 156895189) has the molecular formula C22H22ClF5N4OS and a molecular weight of 520.96 g/mol. Its IUPAC name is 6-[5-(1-chlorocyclopropyl)-3-ethylsulfanyl-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropyl)-1-propan-2-ylimidazo[4,5-c]pyridin-2-one.
| Compound Name | 6-[5-(1-chlorocyclopropyl)-3-ethylsulfanyl-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropyl)-1-propan-2-ylimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 156895189 |
| Molecular Formula | C22H22ClF5N4OS |
| Molecular Weight | 520.96 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 6-[5-(1-chlorocyclopropyl)-3-ethylsulfanyl-2-pyridinyl]-3-(2,2,3,3,3-pentafluoropropyl)-1-propan-2-ylimidazo[4,5-c]pyridin-2-one |
| SMILES | CCSc1cc(C2(Cl)CC2)cnc1-c1cc2c(cn1)n(CC(F)(F)C(F)(F)F)c(=O)n2C(C)C |
| InChI | InChI=1S/C22H22ClF5N4OS/c1-4-34-17-7-13(20(23)5-6-20)9-30-18(17)14-8-15-16(10-29-14)31(19(33)32(15)12(2)3)11-21(24,25)22(26,27)28/h7-10,12H,4-6,11H2,1-3H3 |
| InChIKey | NRVCQZUCAXQECA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.96 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|