C14H11BrF5N3O2S — CID 154691526
2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 154691526) has the molecular formula C14H11BrF5N3O2S and a molecular weight of 460.22 g/mol. Its IUPAC name is 2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154691526 |
| Molecular Formula | C14H11BrF5N3O2S |
| Molecular Weight | 460.22 g/mol |
| Exact Mass | 458.97 |
| IUPAC Name | 2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | CCSc1cc(Br)cnc1-c1ncc(OCC(F)(F)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C14H11BrF5N3O2S/c1-2-26-9-3-7(15)4-21-10(9)11-22-5-8(12(24)23-11)25-6-13(16,17)14(18,19)20/h3-5H,2,6H2,1H3,(H,22,23,24) |
| InChIKey | TZINIIFPNBPWNJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|