C20H18F7N3O3S — CID 170781383
6-[5-(2,2-difluoropropoxy)-3-ethylsulfanyl-2-pyridinyl]-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 170781383) has the molecular formula C20H18F7N3O3S and a molecular weight of 513.44 g/mol. Its IUPAC name is 6-[5-(2,2-difluoropropoxy)-3-ethylsulfanyl-2-pyridinyl]-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | 6-[5-(2,2-difluoropropoxy)-3-ethylsulfanyl-2-pyridinyl]-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 170781383 |
| Molecular Formula | C20H18F7N3O3S |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 6-[5-(2,2-difluoropropoxy)-3-ethylsulfanyl-2-pyridinyl]-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | CCSc1cc(OCC(C)(F)F)cnc1-c1cc2c(cn1)N(CC(F)(F)C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C20H18F7N3O3S/c1-3-34-15-5-12(33-10-18(2,21)22)6-29-16(15)13-4-11-8-32-17(31)30(14(11)7-28-13)9-19(23,24)20(25,26)27/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | GYXRRYYRILEJRT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|