C20H19F5N4O5S — CID 175479390
N-[5-ethylsulfonyl-6-[2-oxo-1-(1,2,2,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]-N-methylacetamide (PubChem CID 175479390) has the molecular formula C20H19F5N4O5S and a molecular weight of 522.45 g/mol. Its IUPAC name is N-[5-ethylsulfonyl-6-[2-oxo-1-(1,2,2,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]-N-methylacetamide.
| Compound Name | N-[5-ethylsulfonyl-6-[2-oxo-1-(1,2,2,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]-N-methylacetamide |
|---|---|
| PubChem CID | 175479390 |
| Molecular Formula | C20H19F5N4O5S |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | N-[5-ethylsulfonyl-6-[2-oxo-1-(1,2,2,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]-N-methylacetamide |
| SMILES | CCS(=O)(=O)c1cc(N(C)C(C)=O)cnc1-c1cc2c(cn1)N(C(F)C(F)(F)C(F)F)C(=O)OC2 |
| InChI | InChI=1S/C20H19F5N4O5S/c1-4-35(32,33)15-6-12(28(3)10(2)30)7-27-16(15)13-5-11-9-34-19(31)29(14(11)8-26-13)18(23)20(24,25)17(21)22/h5-8,17-18H,4,9H2,1-3H3 |
| InChIKey | GAPRWCKQQIBIDM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|