C28H31F5N2O2S — CID 157038113
1-[6-[3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxy-2-pyridinyl]-4-[(Z)-prop-1-enyl]-3-pyridinyl]ethanone;1,1,1,2,2-pentafluorobutane (PubChem CID 157038113) has the molecular formula C28H31F5N2O2S and a molecular weight of 554.63 g/mol. Its IUPAC name is 1-[6-[3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxy-2-pyridinyl]-4-[(Z)-prop-1-enyl]-3-pyridinyl]ethanone;1,1,1,2,2-pentafluorobutane.
| Compound Name | 1-[6-[3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxy-2-pyridinyl]-4-[(Z)-prop-1-enyl]-3-pyridinyl]ethanone;1,1,1,2,2-pentafluorobutane |
|---|---|
| PubChem CID | 157038113 |
| Molecular Formula | C28H31F5N2O2S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 1-[6-[3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxy-2-pyridinyl]-4-[(Z)-prop-1-enyl]-3-pyridinyl]ethanone;1,1,1,2,2-pentafluorobutane |
| SMILES | C=C/C=C\C=C(/C)Oc1cnc(-c2cc(/C=C\C)c(C(C)=O)cn2)c(SCC)c1.CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H26N2O2S.C4H5F5/c1-6-9-10-12-17(4)28-20-14-23(29-8-3)24(26-15-20)22-13-19(11-7-2)21(16-25-22)18(5)27;1-2-3(5,6)4(7,8)9/h6-7,9-16H,1,8H2,2-5H3;2H2,1H3/b10-9-,11-7-,17-12+; |
| InChIKey | NOKZHKBWPCLTNW-LKVBIYGHSA-N |
| XLogP | 9.11 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|