C29H26O4 — CID 166964946
3-O-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl] 1-O-[4-methyl-3-[(Z)-prop-1-enyl]phenyl] benzene-1,3-dicarboxylate (PubChem CID 166964946) has the molecular formula C29H26O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is 3-O-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl] 1-O-[4-methyl-3-[(Z)-prop-1-enyl]phenyl] benzene-1,3-dicarboxylate.
| Compound Name | 3-O-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl] 1-O-[4-methyl-3-[(Z)-prop-1-enyl]phenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 166964946 |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-O-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl] 1-O-[4-methyl-3-[(Z)-prop-1-enyl]phenyl] benzene-1,3-dicarboxylate |
| SMILES | C=C/C=C\c1cc(OC(=O)c2cccc(C(=O)Oc3ccc(C)c(/C=C\C)c3)c2)ccc1C |
| InChI | InChI=1S/C29H26O4/c1-5-7-10-23-19-27(16-14-21(23)4)33-29(31)25-12-8-11-24(17-25)28(30)32-26-15-13-20(3)22(18-26)9-6-2/h5-19H,1H2,2-4H3/b9-6-,10-7- |
| InChIKey | OYQKBZUUHHSKBD-LFPVQMOXSA-N |
| XLogP | 6.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|