C22H22O4 — CID 142305519
1-O-[(2Z,4Z)-2-methylhexa-2,4-dienyl] 3-O-(4-methylphenyl) benzene-1,3-dicarboxylate (PubChem CID 142305519) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-O-[(2Z,4Z)-2-methylhexa-2,4-dienyl] 3-O-(4-methylphenyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-[(2Z,4Z)-2-methylhexa-2,4-dienyl] 3-O-(4-methylphenyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 142305519 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-O-[(2Z,4Z)-2-methylhexa-2,4-dienyl] 3-O-(4-methylphenyl) benzene-1,3-dicarboxylate |
| SMILES | C/C=C\C=C(\C)COC(=O)c1cccc(C(=O)Oc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H22O4/c1-4-5-7-17(3)15-25-21(23)18-8-6-9-19(14-18)22(24)26-20-12-10-16(2)11-13-20/h4-14H,15H2,1-3H3/b5-4-,17-7- |
| InChIKey | IUTMNEXLAXQUIK-VGVSTROMSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|