About anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate)
anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) (PubChem CID 174799198) has the molecular formula C42H38O12
and a molecular weight of 734.75 g/mol. Its IUPAC name is anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate).
Molecular Properties
| Compound Name | anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) |
| PubChem CID | 174799198 |
| Molecular Formula | C42H38O12 |
| Molecular Weight | 734.75 g/mol |
| Exact Mass | 734.24 |
| IUPAC Name | anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) |
| SMILES | CC(=O)COC(=O)c1cccc(C(=O)OCC(C)=O)c1.CC(=O)COC(=O)c1cccc(C(=O)OCC(C)=O)c1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/2C14H14O6.C14H10/c2*1-9(15)7-19-13(17)11-4-3-5-12(6-11)14(18)20-8-10(2)16;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h2*3-6H,7-8H2,1-2H3;1-10H |
| InChIKey | MDFNHQRHQSPIGH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 734.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate)?
The IUPAC name of anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) (CID 174799198) is anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate).
What is the SMILES notation for anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate)?
The canonical SMILES for anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) is CC(=O)COC(=O)c1cccc(C(=O)OCC(C)=O)c1.CC(=O)COC(=O)c1cccc(C(=O)OCC(C)=O)c1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate)?
The InChIKey is MDFNHQRHQSPIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H14O6.C14H10/c2*1-9(15)7-19-13(17)11-4-3-5-12(6-11)14(18)20-8-10(2)16;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h2*3-6H,7-8H2,1-2H3;1-10H.
What are the key properties of anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate)?
anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) has a molecular weight of 734.75 g/mol, XLogP of 6.35, 12 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;bis(bis(2-oxopropyl) benzene-1,3-dicarboxylate) is sourced from PubChem (CID 174799198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).