C14H16O2 — CID 167262821
methyl 4-methyl-3-[(1Z,3Z)-penta-1,3-dienyl]benzoate (PubChem CID 167262821) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 4-methyl-3-[(1Z,3Z)-penta-1,3-dienyl]benzoate.
| Compound Name | methyl 4-methyl-3-[(1Z,3Z)-penta-1,3-dienyl]benzoate |
|---|---|
| PubChem CID | 167262821 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | methyl 4-methyl-3-[(1Z,3Z)-penta-1,3-dienyl]benzoate |
| SMILES | C/C=C\C=C/c1cc(C(=O)OC)ccc1C |
| InChI | InChI=1S/C14H16O2/c1-4-5-6-7-12-10-13(14(15)16-3)9-8-11(12)2/h4-10H,1-3H3/b5-4-,7-6- |
| InChIKey | LWERLBGUICSSIK-RZSVFLSASA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|