C22H17F5N4OS — CID 157038121
1-[5-ethylsulfanyl-6-[8-oxo-7-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-3-yl]-3-pyridinyl]cyclopropane-1-carbonitrile (PubChem CID 157038121) has the molecular formula C22H17F5N4OS and a molecular weight of 480.46 g/mol. Its IUPAC name is 1-[5-ethylsulfanyl-6-[8-oxo-7-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-3-yl]-3-pyridinyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[5-ethylsulfanyl-6-[8-oxo-7-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-3-yl]-3-pyridinyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 157038121 |
| Molecular Formula | C22H17F5N4OS |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 1-[5-ethylsulfanyl-6-[8-oxo-7-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-3-yl]-3-pyridinyl]cyclopropane-1-carbonitrile |
| SMILES | CCSc1cc(C2(C#N)CC2)cnc1-c1cc2ccn(CC(F)(F)C(F)(F)F)c(=O)c2cn1 |
| InChI | InChI=1S/C22H17F5N4OS/c1-2-33-17-8-14(20(11-28)4-5-20)9-30-18(17)16-7-13-3-6-31(19(32)15(13)10-29-16)12-21(23,24)22(25,26)27/h3,6-10H,2,4-5,12H2,1H3 |
| InChIKey | TYBWBWXNNHSOSW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|