C29H27F5N5O3S+ — CID 166806981
1-[5-ethylsulfanyl-1-methoxy-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile (PubChem CID 166806981) has the molecular formula C29H27F5N5O3S+ and a molecular weight of 620.62 g/mol. Its IUPAC name is 1-[5-ethylsulfanyl-1-methoxy-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[5-ethylsulfanyl-1-methoxy-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 166806981 |
| Molecular Formula | C29H27F5N5O3S+ |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 1-[5-ethylsulfanyl-1-methoxy-6-[1-[(4-methoxyphenyl)methyl]-2-oxo-3-(2,2,3,3,3-pentafluoropropyl)imidazo[4,5-c]pyridin-6-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile |
| SMILES | CCSc1cc(C2(C#N)CC2)c[n+](OC)c1-c1cc2c(cn1)n(CC(F)(F)C(F)(F)F)c(=O)n2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H27F5N5O3S/c1-4-43-24-11-19(27(16-35)9-10-27)15-39(42-3)25(24)21-12-22-23(13-36-21)38(17-28(30,31)29(32,33)34)26(40)37(22)14-18-5-7-20(41-2)8-6-18/h5-8,11-13,15H,4,9-10,14,17H2,1-3H3/q+1 |
| InChIKey | LPPDTCIORNNFPO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|