C11H11FN2S — CID 152893427
1-(5-ethylsulfanyl-6-fluoro-3-pyridinyl)cyclopropane-1-carbonitrile (PubChem CID 152893427) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-(5-ethylsulfanyl-6-fluoro-3-pyridinyl)cyclopropane-1-carbonitrile.
| Compound Name | 1-(5-ethylsulfanyl-6-fluoro-3-pyridinyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 152893427 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-(5-ethylsulfanyl-6-fluoro-3-pyridinyl)cyclopropane-1-carbonitrile |
| SMILES | CCSc1cc(C2(C#N)CC2)cnc1F |
| InChI | InChI=1S/C11H11FN2S/c1-2-15-9-5-8(6-14-10(9)12)11(7-13)3-4-11/h5-6H,2-4H2,1H3 |
| InChIKey | UDWSTSHBVWVXFX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|