C21H19F5N4OS — CID 155102160
2-[5-ethylsulfanyl-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-2-methylpropanenitrile (PubChem CID 155102160) has the molecular formula C21H19F5N4OS and a molecular weight of 470.47 g/mol. Its IUPAC name is 2-[5-ethylsulfanyl-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-2-methylpropanenitrile.
| Compound Name | 2-[5-ethylsulfanyl-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 155102160 |
| Molecular Formula | C21H19F5N4OS |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-[5-ethylsulfanyl-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-2-methylpropanenitrile |
| SMILES | CCSc1cc(C(C)(C)C#N)c[n+]([O-])c1-c1cc2ccn(CC(F)(F)C(F)(F)F)c2cn1 |
| InChI | InChI=1S/C21H19F5N4OS/c1-4-32-17-8-14(19(2,3)11-27)10-30(31)18(17)15-7-13-5-6-29(16(13)9-28-15)12-20(22,23)21(24,25)26/h5-10H,4,12H2,1-3H3 |
| InChIKey | DGXLYJAZJJBSGH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|