C17H11F8N3S — CID 162572356
2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-6-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole (PubChem CID 162572356) has the molecular formula C17H11F8N3S and a molecular weight of 441.35 g/mol. Its IUPAC name is 2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-6-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole.
| Compound Name | 2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-6-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 162572356 |
| Molecular Formula | C17H11F8N3S |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-6-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
| SMILES | CCSc1cc(C(F)(F)F)cnc1-c1nc2ccc(C(F)(F)C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C17H11F8N3S/c1-2-29-12-6-9(16(20,21)22)7-26-13(12)14-27-10-4-3-8(5-11(10)28-14)15(18,19)17(23,24)25/h3-7H,2H2,1H3,(H,27,28) |
| InChIKey | OTKWMOVGCYUFBH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|