C15H11F3N2OS2 — CID 162612422
2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-1,3-benzoxazole-5-thiol (PubChem CID 162612422) has the molecular formula C15H11F3N2OS2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-1,3-benzoxazole-5-thiol.
| Compound Name | 2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-1,3-benzoxazole-5-thiol |
|---|---|
| PubChem CID | 162612422 |
| Molecular Formula | C15H11F3N2OS2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]-1,3-benzoxazole-5-thiol |
| SMILES | CCSc1cc(C(F)(F)F)cnc1-c1nc2cc(S)ccc2o1 |
| InChI | InChI=1S/C15H11F3N2OS2/c1-2-23-12-5-8(15(16,17)18)7-19-13(12)14-20-10-6-9(22)3-4-11(10)21-14/h3-7,22H,2H2,1H3 |
| InChIKey | HNPWMIABOBLZNK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|