C13H12BrF5N4S — CID 167506978
5-bromo-3-ethylsulfanyl-2-[4-methyl-5-(2,2,3,3,3-pentafluoropropyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 167506978) has the molecular formula C13H12BrF5N4S and a molecular weight of 431.23 g/mol. Its IUPAC name is 5-bromo-3-ethylsulfanyl-2-[4-methyl-5-(2,2,3,3,3-pentafluoropropyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 5-bromo-3-ethylsulfanyl-2-[4-methyl-5-(2,2,3,3,3-pentafluoropropyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 167506978 |
| Molecular Formula | C13H12BrF5N4S |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 5-bromo-3-ethylsulfanyl-2-[4-methyl-5-(2,2,3,3,3-pentafluoropropyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | CCSc1cc(Br)cnc1-c1nnc(CC(F)(F)C(F)(F)F)n1C |
| InChI | InChI=1S/C13H12BrF5N4S/c1-3-24-8-4-7(14)6-20-10(8)11-22-21-9(23(11)2)5-12(15,16)13(17,18)19/h4,6H,3,5H2,1-2H3 |
| InChIKey | RLPRSXLVIJWCMU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|