C22H19F5N4S — CID 175586904
5-(4-cyclopropylphenyl)-3-ethylsulfanyl-2-[4-methyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 175586904) has the molecular formula C22H19F5N4S and a molecular weight of 466.48 g/mol. Its IUPAC name is 5-(4-cyclopropylphenyl)-3-ethylsulfanyl-2-[4-methyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 5-(4-cyclopropylphenyl)-3-ethylsulfanyl-2-[4-methyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 175586904 |
| Molecular Formula | C22H19F5N4S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 5-(4-cyclopropylphenyl)-3-ethylsulfanyl-2-[4-methyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | CCSc1cc(-c2ccc(C3CC3)cc2)cnc1-c1nnc(/C(F)=C(/F)C(F)(F)F)n1C |
| InChI | InChI=1S/C22H19F5N4S/c1-3-32-16-10-15(14-8-6-13(7-9-14)12-4-5-12)11-28-18(16)21-30-29-20(31(21)2)17(23)19(24)22(25,26)27/h6-12H,3-5H2,1-2H3/b19-17- |
| InChIKey | SHNCUMAGXMHVKE-ZPHPHTNESA-N |
| XLogP | 6.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |