C21H14F7N5S — CID 146383925
2-[5-(3,5-difluoro-2-pyridinyl)-3-ethylsulfanyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridine (PubChem CID 146383925) has the molecular formula C21H14F7N5S and a molecular weight of 501.43 g/mol. Its IUPAC name is 2-[5-(3,5-difluoro-2-pyridinyl)-3-ethylsulfanyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-[5-(3,5-difluoro-2-pyridinyl)-3-ethylsulfanyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 146383925 |
| Molecular Formula | C21H14F7N5S |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 2-[5-(3,5-difluoro-2-pyridinyl)-3-ethylsulfanyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridine |
| SMILES | CCSc1cc(-c2ncc(F)cc2F)cnc1-c1nc2cc(C(F)(F)C(F)(F)F)ncc2n1C |
| InChI | InChI=1S/C21H14F7N5S/c1-3-34-15-4-10(17-12(23)5-11(22)8-31-17)7-30-18(15)19-32-13-6-16(20(24,25)21(26,27)28)29-9-14(13)33(19)2/h4-9H,3H2,1-2H3 |
| InChIKey | MYJPKSDJJACCMI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|