C18H13F5N4S2 — CID 130380491
3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]thieno[2,3-b]pyridine (PubChem CID 130380491) has the molecular formula C18H13F5N4S2 and a molecular weight of 444.45 g/mol. Its IUPAC name is 3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]thieno[2,3-b]pyridine.
| Compound Name | 3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 130380491 |
| Molecular Formula | C18H13F5N4S2 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]thieno[2,3-b]pyridine |
| SMILES | CCSc1c(-c2nc3cc(C(F)(F)C(F)(F)F)ncc3n2C)sc2ncccc12 |
| InChI | InChI=1S/C18H13F5N4S2/c1-3-28-13-9-5-4-6-24-16(9)29-14(13)15-26-10-7-12(17(19,20)18(21,22)23)25-8-11(10)27(15)2/h4-8H,3H2,1-2H3 |
| InChIKey | TYTKVDZTFGYZGB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|