C15H12F3IN4OS — CID 147995964
5-ethylsulfanyl-2-iodo-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol (PubChem CID 147995964) has the molecular formula C15H12F3IN4OS and a molecular weight of 480.25 g/mol. Its IUPAC name is 5-ethylsulfanyl-2-iodo-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol.
| Compound Name | 5-ethylsulfanyl-2-iodo-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 147995964 |
| Molecular Formula | C15H12F3IN4OS |
| Molecular Weight | 480.25 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | 5-ethylsulfanyl-2-iodo-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol |
| SMILES | CCSc1cc(O)c(I)nc1-c1nc2cc(C(F)(F)F)ncc2n1C |
| InChI | InChI=1S/C15H12F3IN4OS/c1-3-25-10-5-9(24)13(19)22-12(10)14-21-7-4-11(15(16,17)18)20-6-8(7)23(14)2/h4-6,24H,3H2,1-2H3 |
| InChIKey | IVZXHOMSGBIACS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|