C12H14F4N2OS — CID 129093045
(Z)-2-ethylsulfanyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]ethenamine (PubChem CID 129093045) has the molecular formula C12H14F4N2OS and a molecular weight of 310.32 g/mol. Its IUPAC name is (Z)-2-ethylsulfanyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]ethenamine.
| Compound Name | (Z)-2-ethylsulfanyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]ethenamine |
|---|---|
| PubChem CID | 129093045 |
| Molecular Formula | C12H14F4N2OS |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (Z)-2-ethylsulfanyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]ethenamine |
| SMILES | CCS/C=C(\N)c1ccc(OCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C12H14F4N2OS/c1-2-20-6-9(17)10-4-3-8(5-18-10)19-7-12(15,16)11(13)14/h3-6,11H,2,7,17H2,1H3/b9-6- |
| InChIKey | ACZCTIMGVJNDNZ-TWGQIWQCSA-N |
| XLogP | 3.37 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|