C10H7ClF4O2 — CID 12644770
4-(2,2,3,3-tetrafluoropropoxy)benzoyl chloride (PubChem CID 12644770) has the molecular formula C10H7ClF4O2 and a molecular weight of 270.61 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropoxy)benzoyl chloride.
| Compound Name | 4-(2,2,3,3-tetrafluoropropoxy)benzoyl chloride |
|---|---|
| PubChem CID | 12644770 |
| Molecular Formula | C10H7ClF4O2 |
| Molecular Weight | 270.61 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropoxy)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H7ClF4O2/c11-8(16)6-1-3-7(4-2-6)17-5-10(14,15)9(12)13/h1-4,9H,5H2 |
| InChIKey | ZCVIXLXOHJVUSH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|