C24H19F4NO2 — CID 155432884
(9-ethylcarbazol-3-yl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone (PubChem CID 155432884) has the molecular formula C24H19F4NO2 and a molecular weight of 429.41 g/mol. Its IUPAC name is (9-ethylcarbazol-3-yl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone.
| Compound Name | (9-ethylcarbazol-3-yl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 155432884 |
| Molecular Formula | C24H19F4NO2 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (9-ethylcarbazol-3-yl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
| SMILES | CCn1c2ccccc2c2cc(C(=O)c3ccc(OCC(F)(F)C(F)F)cc3)ccc21 |
| InChI | InChI=1S/C24H19F4NO2/c1-2-29-20-6-4-3-5-18(20)19-13-16(9-12-21(19)29)22(30)15-7-10-17(11-8-15)31-14-24(27,28)23(25)26/h3-13,23H,2,14H2,1H3 |
| InChIKey | INFHXOSLHWTLGM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|