C12H12F4O4 — CID 43532345
4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]benzoic acid (PubChem CID 43532345) has the molecular formula C12H12F4O4 and a molecular weight of 296.22 g/mol. Its IUPAC name is 4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]benzoic acid.
| Compound Name | 4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 43532345 |
| Molecular Formula | C12H12F4O4 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H12F4O4/c13-11(14)12(15,16)7-19-5-6-20-9-3-1-8(2-4-9)10(17)18/h1-4,11H,5-7H2,(H,17,18) |
| InChIKey | MQRTWMYBNZZBHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|