C13H15F4NO2S — CID 43291426
2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]phenyl]ethanethioamide (PubChem CID 43291426) has the molecular formula C13H15F4NO2S and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]phenyl]ethanethioamide.
| Compound Name | 2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]phenyl]ethanethioamide |
|---|---|
| PubChem CID | 43291426 |
| Molecular Formula | C13H15F4NO2S |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethoxy]phenyl]ethanethioamide |
| SMILES | NC(=S)Cc1ccc(OCCOCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C13H15F4NO2S/c14-12(15)13(16,17)8-19-5-6-20-10-3-1-9(2-4-10)7-11(18)21/h1-4,12H,5-8H2,(H2,18,21) |
| InChIKey | AQOZWAPQTUWWJD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|