C12H14F2O4 — CID 82008841
2-[4-[2-(2,2-difluoroethoxy)ethoxy]phenyl]acetic acid (PubChem CID 82008841) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is 2-[4-[2-(2,2-difluoroethoxy)ethoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[2-(2,2-difluoroethoxy)ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 82008841 |
| Molecular Formula | C12H14F2O4 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[4-[2-(2,2-difluoroethoxy)ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(OCCOCC(F)F)cc1 |
| InChI | InChI=1S/C12H14F2O4/c13-11(14)8-17-5-6-18-10-3-1-9(2-4-10)7-12(15)16/h1-4,11H,5-8H2,(H,15,16) |
| InChIKey | DALISDRAPHOIGI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|