C17H10ClF7O2 — CID 54183533
4-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]benzoyl chloride (PubChem CID 54183533) has the molecular formula C17H10ClF7O2 and a molecular weight of 414.70 g/mol. Its IUPAC name is 4-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]benzoyl chloride.
| Compound Name | 4-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]benzoyl chloride |
|---|---|
| PubChem CID | 54183533 |
| Molecular Formula | C17H10ClF7O2 |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 4-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(-c2ccc(OCC(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H10ClF7O2/c18-14(26)12-3-1-10(2-4-12)11-5-7-13(8-6-11)27-9-15(19,20)16(21,22)17(23,24)25/h1-8H,9H2 |
| InChIKey | PDNLKHHPPRSRDB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|