C11H7F7O4 — CID 18995384
4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]benzoic acid (PubChem CID 18995384) has the molecular formula C11H7F7O4 and a molecular weight of 336.16 g/mol. Its IUPAC name is 4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]benzoic acid.
| Compound Name | 4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 18995384 |
| Molecular Formula | C11H7F7O4 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCC(F)(F)OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F7O4/c12-9(13,22-11(17,18)10(14,15)16)5-21-7-3-1-6(2-4-7)8(19)20/h1-4H,5H2,(H,19,20) |
| InChIKey | ZQJWDNKCYIHBKW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|