C16H12F4O3 — CID 150510109
(2-hydroxyphenyl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone (PubChem CID 150510109) has the molecular formula C16H12F4O3 and a molecular weight of 328.26 g/mol. Its IUPAC name is (2-hydroxyphenyl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone.
| Compound Name | (2-hydroxyphenyl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 150510109 |
| Molecular Formula | C16H12F4O3 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (2-hydroxyphenyl)-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCC(F)(F)C(F)F)cc1)c1ccccc1O |
| InChI | InChI=1S/C16H12F4O3/c17-15(18)16(19,20)9-23-11-7-5-10(6-8-11)14(22)12-3-1-2-4-13(12)21/h1-8,15,21H,9H2 |
| InChIKey | HZQLEGACOJZWKU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|