C20H9F5O4 — CID 59687407
[4-(2-hydroxybenzoyl)phenyl] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 59687407) has the molecular formula C20H9F5O4 and a molecular weight of 408.28 g/mol. Its IUPAC name is [4-(2-hydroxybenzoyl)phenyl] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [4-(2-hydroxybenzoyl)phenyl] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 59687407 |
| Molecular Formula | C20H9F5O4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | [4-(2-hydroxybenzoyl)phenyl] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(c1ccc(OC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1)c1ccccc1O |
| InChI | InChI=1S/C20H9F5O4/c21-14-13(15(22)17(24)18(25)16(14)23)20(28)29-10-7-5-9(6-8-10)19(27)11-3-1-2-4-12(11)26/h1-8,26H |
| InChIKey | DKZSDMFOOCLPOF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|