C15H13ClF4N2O3 — CID 86751397
(2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoyl chloride (PubChem CID 86751397) has the molecular formula C15H13ClF4N2O3 and a molecular weight of 380.73 g/mol. Its IUPAC name is (2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoyl chloride.
| Compound Name | (2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoyl chloride |
|---|---|
| PubChem CID | 86751397 |
| Molecular Formula | C15H13ClF4N2O3 |
| Molecular Weight | 380.73 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoyl chloride |
| SMILES | C[C@H](C(=O)Cl)n1ccn(-c2ccc(OCC(F)(F)C(F)F)cc2)c1=O |
| InChI | InChI=1S/C15H13ClF4N2O3/c1-9(12(16)23)21-6-7-22(14(21)24)10-2-4-11(5-3-10)25-8-15(19,20)13(17)18/h2-7,9,13H,8H2,1H3/t9-/m1/s1 |
| InChIKey | SWUQMENQWNZKDL-SECBINFHSA-N |
| XLogP | 3.24 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|