C12H10F4N2O2 — CID 18713620
1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazol-2-one (PubChem CID 18713620) has the molecular formula C12H10F4N2O2 and a molecular weight of 290.22 g/mol. Its IUPAC name is 1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazol-2-one.
| Compound Name | 1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 18713620 |
| Molecular Formula | C12H10F4N2O2 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazol-2-one |
| SMILES | Cn1ccn(-c2ccc(OC(F)(F)C(F)F)cc2)c1=O |
| InChI | InChI=1S/C12H10F4N2O2/c1-17-6-7-18(11(17)19)8-2-4-9(5-3-8)20-12(15,16)10(13)14/h2-7,10H,1H3 |
| InChIKey | CBGGPUMZBVZYLV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|