C22H19F6N3O3 — CID 10814816
2-[(2R,3S)-3-(2,4-difluorophenyl)-3-hydroxypent-4-en-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one (PubChem CID 10814816) has the molecular formula C22H19F6N3O3 and a molecular weight of 487.40 g/mol. Its IUPAC name is 2-[(2R,3S)-3-(2,4-difluorophenyl)-3-hydroxypent-4-en-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(2R,3S)-3-(2,4-difluorophenyl)-3-hydroxypent-4-en-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 10814816 |
| Molecular Formula | C22H19F6N3O3 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 2-[(2R,3S)-3-(2,4-difluorophenyl)-3-hydroxypent-4-en-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one |
| SMILES | C=C[C@](O)(c1ccc(F)cc1F)[C@@H](C)n1ncn(-c2ccc(OCC(F)(F)C(F)F)cc2)c1=O |
| InChI | InChI=1S/C22H19F6N3O3/c1-3-21(33,17-9-4-14(23)10-18(17)24)13(2)31-20(32)30(12-29-31)15-5-7-16(8-6-15)34-11-22(27,28)19(25)26/h3-10,12-13,19,33H,1,11H2,2H3/t13-,21-/m1/s1 |
| InChIKey | SNAZZXZIGMDARE-LRTDBIEQSA-N |
| XLogP | 4.23 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|