C25H24F9N3O3 — CID 59966588
2-[3-(2,4-difluorophenyl)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhexan-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one (PubChem CID 59966588) has the molecular formula C25H24F9N3O3 and a molecular weight of 585.47 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhexan-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[3-(2,4-difluorophenyl)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhexan-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 59966588 |
| Molecular Formula | C25H24F9N3O3 |
| Molecular Weight | 585.47 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhexan-2-yl]-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-3-one |
| SMILES | CC(C)(C)C(O)C(c1ccc(F)cc1F)C(n1ncn(-c2ccc(OCC(F)(F)C(F)F)cc2)c1=O)C(F)(F)F |
| InChI | InChI=1S/C25H24F9N3O3/c1-23(2,3)20(38)18(16-9-4-13(26)10-17(16)27)19(25(32,33)34)37-22(39)36(12-35-37)14-5-7-15(8-6-14)40-11-24(30,31)21(28)29/h4-10,12,18-21,38H,11H2,1-3H3 |
| InChIKey | QFKJTRQTBCMSJT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|