C26H25F6N6O5+ — CID 22081044
[1-[2-(2,4-difluorophenyl)-2-hydroxy-3-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]butyl]-1,2,4-triazol-4-ium-4-yl]methyl acetate (PubChem CID 22081044) has the molecular formula C26H25F6N6O5+ and a molecular weight of 615.51 g/mol. Its IUPAC name is [1-[2-(2,4-difluorophenyl)-2-hydroxy-3-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]butyl]-1,2,4-triazol-4-ium-4-yl]methyl acetate.
| Compound Name | [1-[2-(2,4-difluorophenyl)-2-hydroxy-3-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]butyl]-1,2,4-triazol-4-ium-4-yl]methyl acetate |
|---|---|
| PubChem CID | 22081044 |
| Molecular Formula | C26H25F6N6O5+ |
| Molecular Weight | 615.51 g/mol |
| Exact Mass | 615.18 |
| IUPAC Name | [1-[2-(2,4-difluorophenyl)-2-hydroxy-3-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]butyl]-1,2,4-triazol-4-ium-4-yl]methyl acetate |
| SMILES | CC(=O)OC[n+]1cnn(CC(O)(c2ccc(F)cc2F)C(C)n2ncn(-c3ccc(OCC(F)(F)C(F)F)cc3)c2=O)c1 |
| InChI | InChI=1S/C26H25F6N6O5/c1-16(38-24(40)37(13-34-38)19-4-6-20(7-5-19)42-11-26(31,32)23(29)30)25(41,21-8-3-18(27)9-22(21)28)10-36-14-35(12-33-36)15-43-17(2)39/h3-9,12-14,16,23,41H,10-11,15H2,1-2H3/q+1 |
| InChIKey | XYBZVJWUHLUBRF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|