C27H28F6N6O2 — CID 59093747
2-[(2R,3S)-3-(2,4-difluorophenyl)-4-methyl-3-(1,2,4-triazol-1-ylmethyl)pentan-2-yl]-4-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]-1,2,4-triazol-3-one (PubChem CID 59093747) has the molecular formula C27H28F6N6O2 and a molecular weight of 582.55 g/mol. Its IUPAC name is 2-[(2R,3S)-3-(2,4-difluorophenyl)-4-methyl-3-(1,2,4-triazol-1-ylmethyl)pentan-2-yl]-4-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(2R,3S)-3-(2,4-difluorophenyl)-4-methyl-3-(1,2,4-triazol-1-ylmethyl)pentan-2-yl]-4-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 59093747 |
| Molecular Formula | C27H28F6N6O2 |
| Molecular Weight | 582.55 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | 2-[(2R,3S)-3-(2,4-difluorophenyl)-4-methyl-3-(1,2,4-triazol-1-ylmethyl)pentan-2-yl]-4-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]-1,2,4-triazol-3-one |
| SMILES | CC(C)[C@@](Cn1cncn1)(c1ccc(F)cc1F)[C@@H](C)n1ncn(-c2ccc(OCC(F)(F)C(C)(F)F)cc2)c1=O |
| InChI | InChI=1S/C27H28F6N6O2/c1-17(2)26(12-37-15-34-14-35-37,22-10-5-19(28)11-23(22)29)18(3)39-24(40)38(16-36-39)20-6-8-21(9-7-20)41-13-27(32,33)25(4,30)31/h5-11,14-18H,12-13H2,1-4H3/t18-,26-/m1/s1 |
| InChIKey | CGNFCTXFPZGRGJ-WXTAPIANSA-N |
| XLogP | 5.43 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|