C28H28F6N6O — CID 59880302
1-[(2S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]ethenyl]-1,2,4-triazole (PubChem CID 59880302) has the molecular formula C28H28F6N6O and a molecular weight of 578.56 g/mol. Its IUPAC name is 1-[(2S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]ethenyl]-1,2,4-triazole.
| Compound Name | 1-[(2S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]ethenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 59880302 |
| Molecular Formula | C28H28F6N6O |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 1-[(2S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3,3-tetrafluorobutoxy)phenyl]ethenyl]-1,2,4-triazole |
| SMILES | CC(C)[C@](Cn1cncn1)(Cn1cnc(/C=C/c2ccc(OCC(F)(F)C(C)(F)F)cc2)n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H28F6N6O/c1-19(2)27(13-39-17-35-16-37-39,23-10-7-21(29)12-24(23)30)14-40-18-36-25(38-40)11-6-20-4-8-22(9-5-20)41-15-28(33,34)26(3,31)32/h4-12,16-19H,13-15H2,1-3H3/b11-6+/t27-/m0/s1 |
| InChIKey | YZKCWURHHRAUFU-NBHGYFDZSA-N |
| XLogP | 6.28 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|