C28H26F6N4OS — CID 59921151
2-[(2R)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-4-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,3-thiazole (PubChem CID 59921151) has the molecular formula C28H26F6N4OS and a molecular weight of 580.60 g/mol. Its IUPAC name is 2-[(2R)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-4-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,3-thiazole.
| Compound Name | 2-[(2R)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-4-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 59921151 |
| Molecular Formula | C28H26F6N4OS |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 2-[(2R)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-4-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,3-thiazole |
| SMILES | CC(C)[C@@](Cc1nc(/C=C/c2ccc(OCC(F)(F)C(F)F)cc2)cs1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H26F6N4OS/c1-18(2)27(14-38-17-35-16-36-38,23-10-6-20(29)11-24(23)30)12-25-37-21(13-40-25)7-3-19-4-8-22(9-5-19)39-15-28(33,34)26(31)32/h3-11,13,16-18,26H,12,14-15H2,1-2H3/b7-3+/t27-/m1/s1 |
| InChIKey | JRTCYWCHTRMUGS-XGUNSXMVSA-N |
| XLogP | 7.30 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|